| Name | m-phenylene dibenzoate |
| Synonyms | Dibenzoylresorcinol Resorcinol dibenzoate M-PHENYLENE DIBENZOATE m-phenylene dibenzoate 1,3-DIBENZOYLOXYBENZENE 1,3-Dibenzoyloxybenzene 1,3-PHENYLENEDIBENZOATE 1,3-Phenylene dibenzoate 1,3-Bis(benzoyloxy)benzene 1,3-BENZENEDIOL DIBENZOATE 1,3-Benzenediol, dibenzoate benzene-1,3-diyl dibenzoate 3-(Benzoyloxy)phenyl benzoate Bisbenzoic acid 1,3-phenylene ester |
| CAS | 94-01-9 |
| EINECS | 202-294-8 |
| InChI | InChI=1/C20H14O4/c21-19(15-8-3-1-4-9-15)23-17-12-7-13-18(14-17)24-20(22)16-10-5-2-6-11-16/h1-14H |
| Molecular Formula | C20H14O4 |
| Molar Mass | 318.32 |
| Density | 1.2086 (rough estimate) |
| Melting Point | 115-117 °C |
| Boling Point | 450 °C |
| Flash Point | 93°C |
| Vapor Presure | 2.58E-09mmHg at 25°C |
| BRN | 2059467 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5400 (estimate) |
| MDL | MFCD00016576 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| RTECS | VH0590000 |
| TSCA | Yes |
| HS Code | 29173990 |
| Toxicity | LD50 ipr-mus: 8000 mg/kg JAPMA8 46,185,57 |
| Raw Materials | Hydrochloric acid Acetic acid Toluene Pyridine Resorcinol Benzoyl chloride |
| Downstream Products | RESORCINOL MONOBENZOATE |
| BRN | 2059467 |
| EPA chemical information | 1,3-Benzenediol, dibenzoate (94-01-9) |
| category | toxic substances |
| toxicity classification | low toxicity |
| acute toxicity | abdominal cavity-mouse LD50: 8000 mg/kg |
| flammability hazard characteristics | Combustible; combustion produces stimulating smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | Dry powder, foam, sand, carbon dioxide, mist water |
| category | toxic substances |
| toxicity classification | low toxicity |
| acute toxicity | abdominal cavity-mouse LD50: 8000 mg/kg |
| flammability hazard characteristics | combustible; Combustion produces stimulating smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| extinguishing agent | dry powder, foam, sand, carbon dioxide, mist water |
| EPA chemical information | information provided by: ofmpub.epa.gov (external link) |